C17H20F5NO2 — CID 56531211
(E)-3-[2-(difluoromethoxy)phenyl]-N-(2,2-dimethylpropyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 56531211) has the molecular formula C17H20F5NO2 and a molecular weight of 365.34 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-(2,2-dimethylpropyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-(2,2-dimethylpropyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 56531211 |
| Molecular Formula | C17H20F5NO2 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-(2,2-dimethylpropyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | CC(C)(C)CN(CC(F)(F)F)C(=O)/C=C/c1ccccc1OC(F)F |
| InChI | InChI=1S/C17H20F5NO2/c1-16(2,3)10-23(11-17(20,21)22)14(24)9-8-12-6-4-5-7-13(12)25-15(18)19/h4-9,15H,10-11H2,1-3H3/b9-8+ |
| InChIKey | XPFFIMACCQFQEN-CMDGGOBGSA-N |
| XLogP | 4.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|