C22H33N5O3S — CID 56532061
2-[4-(1-cyano-2-methylpropyl)piperazin-1-yl]-2-oxo-N-(4-piperidin-1-ylphenyl)ethanesulfonamide (PubChem CID 56532061) has the molecular formula C22H33N5O3S and a molecular weight of 447.61 g/mol. Its IUPAC name is 2-[4-(1-cyano-2-methylpropyl)piperazin-1-yl]-2-oxo-N-(4-piperidin-1-ylphenyl)ethanesulfonamide.
| Compound Name | 2-[4-(1-cyano-2-methylpropyl)piperazin-1-yl]-2-oxo-N-(4-piperidin-1-ylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 56532061 |
| Molecular Formula | C22H33N5O3S |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-[4-(1-cyano-2-methylpropyl)piperazin-1-yl]-2-oxo-N-(4-piperidin-1-ylphenyl)ethanesulfonamide |
| SMILES | CC(C)C(C#N)N1CCN(C(=O)CS(=O)(=O)Nc2ccc(N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H33N5O3S/c1-18(2)21(16-23)26-12-14-27(15-13-26)22(28)17-31(29,30)24-19-6-8-20(9-7-19)25-10-4-3-5-11-25/h6-9,18,21,24H,3-5,10-15,17H2,1-2H3 |
| InChIKey | UODYPTIAWQLDDX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|