C23H27FN4O — CID 56539587
2-[3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]propyl-methylamino]-N-(1-phenylethyl)acetamide (PubChem CID 56539587) has the molecular formula C23H27FN4O and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-[3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]propyl-methylamino]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]propyl-methylamino]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 56539587 |
| Molecular Formula | C23H27FN4O |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]propyl-methylamino]-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)CN(C)CCCc1cc(-c2ccc(F)cc2)n[nH]1)c1ccccc1 |
| InChI | InChI=1S/C23H27FN4O/c1-17(18-7-4-3-5-8-18)25-23(29)16-28(2)14-6-9-21-15-22(27-26-21)19-10-12-20(24)13-11-19/h3-5,7-8,10-13,15,17H,6,9,14,16H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | OEEVWEHEUQVEMC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |