C26H28N2O4 — CID 56542453
methyl 2-[[2-(N-benzylanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate (PubChem CID 56542453) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl 2-[[2-(N-benzylanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate.
| Compound Name | methyl 2-[[2-(N-benzylanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate |
|---|---|
| PubChem CID | 56542453 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | methyl 2-[[2-(N-benzylanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate |
| SMILES | COC(=O)C(C)(COc1ccccc1)NCC(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O4/c1-26(25(30)31-2,20-32-23-16-10-5-11-17-23)27-18-24(29)28(22-14-8-4-9-15-22)19-21-12-6-3-7-13-21/h3-17,27H,18-20H2,1-2H3 |
| InChIKey | CLUJVHOZRPANKN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |