C20H23ClN2O4 — CID 56542171
methyl 2-[[2-(3-chloro-4-methylanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate (PubChem CID 56542171) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is methyl 2-[[2-(3-chloro-4-methylanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate.
| Compound Name | methyl 2-[[2-(3-chloro-4-methylanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate |
|---|---|
| PubChem CID | 56542171 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | methyl 2-[[2-(3-chloro-4-methylanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate |
| SMILES | COC(=O)C(C)(COc1ccccc1)NCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClN2O4/c1-14-9-10-15(11-17(14)21)23-18(24)12-22-20(2,19(25)26-3)13-27-16-7-5-4-6-8-16/h4-11,22H,12-13H2,1-3H3,(H,23,24) |
| InChIKey | MYIKTBWYHFCTRI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |