C25H35N3O2 — CID 56542974
2-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-methyl-N-(1-phenylethyl)acetamide (PubChem CID 56542974) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 2-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-methyl-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-methyl-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 56542974 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 2-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-methyl-N-(1-phenylethyl)acetamide |
| SMILES | CC(CN1CCOCC1)N(CC(=O)N(C)C(C)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H35N3O2/c1-21(18-27-14-16-30-17-15-27)28(19-23-10-6-4-7-11-23)20-25(29)26(3)22(2)24-12-8-5-9-13-24/h4-13,21-22H,14-20H2,1-3H3 |
| InChIKey | WJZGDLSMUFOBMI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |