C25H35N3O3 — CID 56570050
2-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-[2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 56570050) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 2-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-[2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 56570050 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 2-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CN(Cc2ccccc2)C(C)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C25H35N3O3/c1-21(18-27-14-16-31-17-15-27)28(19-23-6-4-3-5-7-23)20-25(29)26-13-12-22-8-10-24(30-2)11-9-22/h3-11,21H,12-20H2,1-2H3,(H,26,29) |
| InChIKey | WIEOZVKDZDDALK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |