C17H14F3NO5 — CID 56543418
methyl 2-hydroxy-3-[[2-[2-(trifluoromethyl)phenoxy]acetyl]amino]benzoate (PubChem CID 56543418) has the molecular formula C17H14F3NO5 and a molecular weight of 369.30 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[2-[2-(trifluoromethyl)phenoxy]acetyl]amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[[2-[2-(trifluoromethyl)phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 56543418 |
| Molecular Formula | C17H14F3NO5 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | methyl 2-hydroxy-3-[[2-[2-(trifluoromethyl)phenoxy]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)COc2ccccc2C(F)(F)F)c1O |
| InChI | InChI=1S/C17H14F3NO5/c1-25-16(24)10-5-4-7-12(15(10)23)21-14(22)9-26-13-8-3-2-6-11(13)17(18,19)20/h2-8,23H,9H2,1H3,(H,21,22) |
| InChIKey | LVKJKVDAQDOULU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|