C26H30N4O2 — CID 56548048
N-[2-[(2-carbamoylpyrrolidin-1-yl)methyl]phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 56548048) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[2-[(2-carbamoylpyrrolidin-1-yl)methyl]phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-[2-[(2-carbamoylpyrrolidin-1-yl)methyl]phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 56548048 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-[2-[(2-carbamoylpyrrolidin-1-yl)methyl]phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | CC1CCc2[nH]c3c(C(=O)Nc4ccccc4CN4CCCC4C(N)=O)cccc3c2C1 |
| InChI | InChI=1S/C26H30N4O2/c1-16-11-12-22-20(14-16)18-7-4-8-19(24(18)28-22)26(32)29-21-9-3-2-6-17(21)15-30-13-5-10-23(30)25(27)31/h2-4,6-9,16,23,28H,5,10-15H2,1H3,(H2,27,31)(H,29,32) |
| InChIKey | HHPZNZRCDIGTET-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|