C22H29N7OS — CID 56549537
4-methyl-N-[1-[5-(5-phenyltetrazol-2-yl)pentyl]piperidin-4-yl]-1,3-thiazole-5-carboxamide (PubChem CID 56549537) has the molecular formula C22H29N7OS and a molecular weight of 439.59 g/mol. Its IUPAC name is 4-methyl-N-[1-[5-(5-phenyltetrazol-2-yl)pentyl]piperidin-4-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[1-[5-(5-phenyltetrazol-2-yl)pentyl]piperidin-4-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 56549537 |
| Molecular Formula | C22H29N7OS |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 4-methyl-N-[1-[5-(5-phenyltetrazol-2-yl)pentyl]piperidin-4-yl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NC1CCN(CCCCCn2nnc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C22H29N7OS/c1-17-20(31-16-23-17)22(30)24-19-10-14-28(15-11-19)12-6-3-7-13-29-26-21(25-27-29)18-8-4-2-5-9-18/h2,4-5,8-9,16,19H,3,6-7,10-15H2,1H3,(H,24,30) |
| InChIKey | LKAAYDLEOBMLQT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|