About (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate
(3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate (PubChem CID 56549566) has the molecular formula C14H22O3S
and a molecular weight of 270.39 g/mol. Its IUPAC name is (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate.
Molecular Properties
| Compound Name | (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate |
| PubChem CID | 56549566 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate |
| SMILES | CC(C)CCS(=O)(=O)Oc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C14H22O3S/c1-11(2)8-9-18(15,16)17-14-7-5-6-13(10-14)12(3)4/h5-7,10-12H,8-9H2,1-4H3 |
| InChIKey | KQTVAVNVDXIELX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate?
The IUPAC name of (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate (CID 56549566) is (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate.
What is the SMILES notation for (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate?
The canonical SMILES for (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate is CC(C)CCS(=O)(=O)Oc1cccc(C(C)C)c1.
What is the InChIKey of (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate?
The InChIKey is KQTVAVNVDXIELX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3S/c1-11(2)8-9-18(15,16)17-14-7-5-6-13(10-14)12(3)4/h5-7,10-12H,8-9H2,1-4H3.
What are the key properties of (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate?
(3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate has a molecular weight of 270.39 g/mol, XLogP of 3.56, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-ylphenyl) 3-methylbutane-1-sulfonate is sourced from PubChem (CID 56549566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).