C19H29N3O — CID 56549576
N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methyl-5-pyrazol-1-ylpentan-1-amine (PubChem CID 56549576) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methyl-5-pyrazol-1-ylpentan-1-amine.
| Compound Name | N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methyl-5-pyrazol-1-ylpentan-1-amine |
|---|---|
| PubChem CID | 56549576 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methyl-5-pyrazol-1-ylpentan-1-amine |
| SMILES | COc1c(C)cc(CN(C)CCCCCn2cccn2)cc1C |
| InChI | InChI=1S/C19H29N3O/c1-16-13-18(14-17(2)19(16)23-4)15-21(3)10-6-5-7-11-22-12-8-9-20-22/h8-9,12-14H,5-7,10-11,15H2,1-4H3 |
| InChIKey | GYKMJLFXQUDHSO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|