C20H21BrN2O3S — CID 56551508
3-bromo-2-hydroxy-5-methyl-N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]benzamide (PubChem CID 56551508) has the molecular formula C20H21BrN2O3S and a molecular weight of 449.37 g/mol. Its IUPAC name is 3-bromo-2-hydroxy-5-methyl-N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]benzamide.
| Compound Name | 3-bromo-2-hydroxy-5-methyl-N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 56551508 |
| Molecular Formula | C20H21BrN2O3S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 3-bromo-2-hydroxy-5-methyl-N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]benzamide |
| SMILES | Cc1cc(Br)c(O)c(C(=O)Nc2ccc(CC(=O)N3CCSCC3)cc2)c1 |
| InChI | InChI=1S/C20H21BrN2O3S/c1-13-10-16(19(25)17(21)11-13)20(26)22-15-4-2-14(3-5-15)12-18(24)23-6-8-27-9-7-23/h2-5,10-11,25H,6-9,12H2,1H3,(H,22,26) |
| InChIKey | JYYXOIBQFVZVJH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |