C21H19ClN4O3 — CID 56552765
1-(4-chlorophenyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 56552765) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 56552765 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1-c1cc(NC(=O)C2CCN(c3ccc(Cl)cc3)C2=O)n[nH]1 |
| InChI | InChI=1S/C21H19ClN4O3/c1-29-18-5-3-2-4-15(18)17-12-19(25-24-17)23-20(27)16-10-11-26(21(16)28)14-8-6-13(22)7-9-14/h2-9,12,16H,10-11H2,1H3,(H2,23,24,25,27) |
| InChIKey | DOFNNIXVENWCEW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|