C22H31N5O3 — CID 56553698
1-[2-(4-methyl-2-oxo-1H-imidazol-3-yl)phenyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]urea (PubChem CID 56553698) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[2-(4-methyl-2-oxo-1H-imidazol-3-yl)phenyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]urea.
| Compound Name | 1-[2-(4-methyl-2-oxo-1H-imidazol-3-yl)phenyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 56553698 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-[2-(4-methyl-2-oxo-1H-imidazol-3-yl)phenyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]urea |
| SMILES | Cc1c[nH]c(=O)n1-c1ccccc1NC(=O)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C22H31N5O3/c1-17-15-23-21(29)27(17)19-8-4-3-7-18(19)25-20(28)24-16-22(9-5-2-6-10-22)26-11-13-30-14-12-26/h3-4,7-8,15H,2,5-6,9-14,16H2,1H3,(H,23,29)(H2,24,25,28) |
| InChIKey | WDCWWQAWXYKCRV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |