C21H23N5O4 — CID 56554813
4-methoxy-N-[2-[[2-(4-methyl-2-oxo-1H-imidazol-3-yl)phenyl]carbamoylamino]ethyl]benzamide (PubChem CID 56554813) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[2-(4-methyl-2-oxo-1H-imidazol-3-yl)phenyl]carbamoylamino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[[2-(4-methyl-2-oxo-1H-imidazol-3-yl)phenyl]carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 56554813 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-methoxy-N-[2-[[2-(4-methyl-2-oxo-1H-imidazol-3-yl)phenyl]carbamoylamino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)Nc2ccccc2-n2c(C)c[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H23N5O4/c1-14-13-24-21(29)26(14)18-6-4-3-5-17(18)25-20(28)23-12-11-22-19(27)15-7-9-16(30-2)10-8-15/h3-10,13H,11-12H2,1-2H3,(H,22,27)(H,24,29)(H2,23,25,28) |
| InChIKey | UWYQSPBJLPZDQV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|