C19H22N8O2S — CID 56553767
1-[(2-methyl-1,3-thiazol-4-yl)methyl]-N'-[4-(tetrazol-1-yl)benzoyl]piperidine-4-carbohydrazide (PubChem CID 56553767) has the molecular formula C19H22N8O2S and a molecular weight of 426.51 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-N'-[4-(tetrazol-1-yl)benzoyl]piperidine-4-carbohydrazide.
| Compound Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-N'-[4-(tetrazol-1-yl)benzoyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 56553767 |
| Molecular Formula | C19H22N8O2S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-N'-[4-(tetrazol-1-yl)benzoyl]piperidine-4-carbohydrazide |
| SMILES | Cc1nc(CN2CCC(C(=O)NNC(=O)c3ccc(-n4cnnn4)cc3)CC2)cs1 |
| InChI | InChI=1S/C19H22N8O2S/c1-13-21-16(11-30-13)10-26-8-6-15(7-9-26)19(29)23-22-18(28)14-2-4-17(5-3-14)27-12-20-24-25-27/h2-5,11-12,15H,6-10H2,1H3,(H,22,28)(H,23,29) |
| InChIKey | CTIFUILGLJCMEX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|