C19H24ClF3N4O2 — CID 56555074
1-N-(3-chloro-4-piperidin-1-ylphenyl)-2-N-(2,2,2-trifluoroethyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 56555074) has the molecular formula C19H24ClF3N4O2 and a molecular weight of 432.87 g/mol. Its IUPAC name is 1-N-(3-chloro-4-piperidin-1-ylphenyl)-2-N-(2,2,2-trifluoroethyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-(3-chloro-4-piperidin-1-ylphenyl)-2-N-(2,2,2-trifluoroethyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 56555074 |
| Molecular Formula | C19H24ClF3N4O2 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1-N-(3-chloro-4-piperidin-1-ylphenyl)-2-N-(2,2,2-trifluoroethyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCCN1C(=O)Nc1ccc(N2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C19H24ClF3N4O2/c20-14-11-13(6-7-15(14)26-8-2-1-3-9-26)25-18(29)27-10-4-5-16(27)17(28)24-12-19(21,22)23/h6-7,11,16H,1-5,8-10,12H2,(H,24,28)(H,25,29) |
| InChIKey | OGXCNKWJTYSUPB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|