C21H20BrFN2O — CID 56555826
8-bromo-1-[[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]quinolin-4-one (PubChem CID 56555826) has the molecular formula C21H20BrFN2O and a molecular weight of 415.31 g/mol. Its IUPAC name is 8-bromo-1-[[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]quinolin-4-one.
| Compound Name | 8-bromo-1-[[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]quinolin-4-one |
|---|---|
| PubChem CID | 56555826 |
| Molecular Formula | C21H20BrFN2O |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 8-bromo-1-[[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]quinolin-4-one |
| SMILES | O=c1ccn(CN2CCCC2Cc2cccc(F)c2)c2c(Br)cccc12 |
| InChI | InChI=1S/C21H20BrFN2O/c22-19-8-2-7-18-20(26)9-11-25(21(18)19)14-24-10-3-6-17(24)13-15-4-1-5-16(23)12-15/h1-2,4-5,7-9,11-12,17H,3,6,10,13-14H2 |
| InChIKey | JKBMAJLRFYWUMW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |