C21H32N4O3S — CID 56557001
3-[2-[[1-(2-ethylbutanoyl)piperidin-4-yl]carbamoylamino]phenyl]sulfanylpropanamide (PubChem CID 56557001) has the molecular formula C21H32N4O3S and a molecular weight of 420.58 g/mol. Its IUPAC name is 3-[2-[[1-(2-ethylbutanoyl)piperidin-4-yl]carbamoylamino]phenyl]sulfanylpropanamide.
| Compound Name | 3-[2-[[1-(2-ethylbutanoyl)piperidin-4-yl]carbamoylamino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 56557001 |
| Molecular Formula | C21H32N4O3S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 3-[2-[[1-(2-ethylbutanoyl)piperidin-4-yl]carbamoylamino]phenyl]sulfanylpropanamide |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccccc2SCCC(N)=O)CC1 |
| InChI | InChI=1S/C21H32N4O3S/c1-3-15(4-2)20(27)25-12-9-16(10-13-25)23-21(28)24-17-7-5-6-8-18(17)29-14-11-19(22)26/h5-8,15-16H,3-4,9-14H2,1-2H3,(H2,22,26)(H2,23,24,28) |
| InChIKey | FUWKKGBLYNDGGZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |