C17H13F3N2O5S — CID 56561993
N-methyl-1,3-dioxo-N-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-sulfonamide (PubChem CID 56561993) has the molecular formula C17H13F3N2O5S and a molecular weight of 414.36 g/mol. Its IUPAC name is N-methyl-1,3-dioxo-N-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-sulfonamide.
| Compound Name | N-methyl-1,3-dioxo-N-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56561993 |
| Molecular Formula | C17H13F3N2O5S |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | N-methyl-1,3-dioxo-N-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-sulfonamide |
| SMILES | CN(Cc1ccc(OC(F)(F)F)cc1)S(=O)(=O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C17H13F3N2O5S/c1-22(9-10-2-4-11(5-3-10)27-17(18,19)20)28(25,26)12-6-7-13-14(8-12)16(24)21-15(13)23/h2-8H,9H2,1H3,(H,21,23,24) |
| InChIKey | WCSKQDRAZCTMFO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|