C22H22N4O3S — CID 56562120
4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(1H-indol-3-yl)acetyl]-4-oxobutanehydrazide (PubChem CID 56562120) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(1H-indol-3-yl)acetyl]-4-oxobutanehydrazide.
| Compound Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(1H-indol-3-yl)acetyl]-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 56562120 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(1H-indol-3-yl)acetyl]-4-oxobutanehydrazide |
| SMILES | O=C(CCC(=O)N1CCSc2ccccc21)NNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H22N4O3S/c27-20(9-10-22(29)26-11-12-30-19-8-4-3-7-18(19)26)24-25-21(28)13-15-14-23-17-6-2-1-5-16(15)17/h1-8,14,23H,9-13H2,(H,24,27)(H,25,28) |
| InChIKey | VZUCQGZUMOVKCK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|