C22H25N3O4S — CID 56564420
4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(2-ethylphenoxy)acetyl]-4-oxobutanehydrazide (PubChem CID 56564420) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(2-ethylphenoxy)acetyl]-4-oxobutanehydrazide.
| Compound Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(2-ethylphenoxy)acetyl]-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 56564420 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(2-ethylphenoxy)acetyl]-4-oxobutanehydrazide |
| SMILES | CCc1ccccc1OCC(=O)NNC(=O)CCC(=O)N1CCSc2ccccc21 |
| InChI | InChI=1S/C22H25N3O4S/c1-2-16-7-3-5-9-18(16)29-15-21(27)24-23-20(26)11-12-22(28)25-13-14-30-19-10-6-4-8-17(19)25/h3-10H,2,11-15H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | GWGKKTOYVXUBCE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|