C22H22N4O3S — CID 56562249
N'-[4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxobutanoyl]-1-methylindole-3-carbohydrazide (PubChem CID 56562249) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N'-[4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxobutanoyl]-1-methylindole-3-carbohydrazide.
| Compound Name | N'-[4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxobutanoyl]-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 56562249 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N'-[4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxobutanoyl]-1-methylindole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)CCC(=O)N2CCSc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C22H22N4O3S/c1-25-14-16(15-6-2-3-7-17(15)25)22(29)24-23-20(27)10-11-21(28)26-12-13-30-19-9-5-4-8-18(19)26/h2-9,14H,10-13H2,1H3,(H,23,27)(H,24,29) |
| InChIKey | DQXIFMBWDBYNET-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|