C20H21N3O5S2 — CID 56567210
N'-[4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxobutanoyl]-4-methylsulfonylbenzohydrazide (PubChem CID 56567210) has the molecular formula C20H21N3O5S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is N'-[4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxobutanoyl]-4-methylsulfonylbenzohydrazide.
| Compound Name | N'-[4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxobutanoyl]-4-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 56567210 |
| Molecular Formula | C20H21N3O5S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N'-[4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxobutanoyl]-4-methylsulfonylbenzohydrazide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NNC(=O)CCC(=O)N2CCSc3ccccc32)cc1 |
| InChI | InChI=1S/C20H21N3O5S2/c1-30(27,28)15-8-6-14(7-9-15)20(26)22-21-18(24)10-11-19(25)23-12-13-29-17-5-3-2-4-16(17)23/h2-9H,10-13H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | CMURLRAIWQDHOF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|