C22H26N4O3S — CID 56564819
4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(2,4-dimethylanilino)acetyl]-4-oxobutanehydrazide (PubChem CID 56564819) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(2,4-dimethylanilino)acetyl]-4-oxobutanehydrazide.
| Compound Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(2,4-dimethylanilino)acetyl]-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 56564819 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N'-[2-(2,4-dimethylanilino)acetyl]-4-oxobutanehydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)CCC(=O)N2CCSc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C22H26N4O3S/c1-15-7-8-17(16(2)13-15)23-14-21(28)25-24-20(27)9-10-22(29)26-11-12-30-19-6-4-3-5-18(19)26/h3-8,13,23H,9-12,14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | GOPWGAPYRQFZAJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|