C23H21FN2O4S — CID 56566627
N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-3-(benzenesulfonylmethyl)-N-methylbenzamide (PubChem CID 56566627) has the molecular formula C23H21FN2O4S and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-3-(benzenesulfonylmethyl)-N-methylbenzamide.
| Compound Name | N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-3-(benzenesulfonylmethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 56566627 |
| Molecular Formula | C23H21FN2O4S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-3-(benzenesulfonylmethyl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1cccc(CS(=O)(=O)c2ccccc2)c1)C(C(N)=O)c1cccc(F)c1 |
| InChI | InChI=1S/C23H21FN2O4S/c1-26(21(22(25)27)17-8-6-10-19(24)14-17)23(28)18-9-5-7-16(13-18)15-31(29,30)20-11-3-2-4-12-20/h2-14,21H,15H2,1H3,(H2,25,27) |
| InChIKey | XDEMMZAOFMTFHS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |