C17H21NO — CID 56574292
N-[1-(1-benzofuran-2-yl)ethyl]-N-methylcyclohex-2-en-1-amine (PubChem CID 56574292) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-N-methylcyclohex-2-en-1-amine.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-N-methylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 56574292 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-N-methylcyclohex-2-en-1-amine |
| SMILES | CC(c1cc2ccccc2o1)N(C)C1C=CCCC1 |
| InChI | InChI=1S/C17H21NO/c1-13(18(2)15-9-4-3-5-10-15)17-12-14-8-6-7-11-16(14)19-17/h4,6-9,11-13,15H,3,5,10H2,1-2H3 |
| InChIKey | ZZHOPDMRUMKYKO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|