C21H23NO6 — CID 56576231
methyl 2-hydroxy-3-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]benzoate (PubChem CID 56576231) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]benzoate |
|---|---|
| PubChem CID | 56576231 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | methyl 2-hydroxy-3-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]benzoate |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)Nc2cccc(C(=O)OC)c2O)cc1 |
| InChI | InChI=1S/C21H23NO6/c1-3-13-28-15-9-7-14(8-10-15)18(23)11-12-19(24)22-17-6-4-5-16(20(17)25)21(26)27-2/h4-10,25H,3,11-13H2,1-2H3,(H,22,24) |
| InChIKey | XWBARVNWUMKYMP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|