C21H25N3O4S — CID 56579773
S-[4-[4-[(4-methoxybenzoyl)amino]butanoylamino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56579773) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is S-[4-[4-[(4-methoxybenzoyl)amino]butanoylamino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[4-[(4-methoxybenzoyl)amino]butanoylamino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56579773 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | S-[4-[4-[(4-methoxybenzoyl)amino]butanoylamino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | COc1ccc(C(=O)NCCCC(=O)Nc2ccc(SC(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-24(2)21(27)29-18-12-8-16(9-13-18)23-19(25)5-4-14-22-20(26)15-6-10-17(28-3)11-7-15/h6-13H,4-5,14H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | UPWWHFDJLQJVBX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|