C18H34N4O4S — CID 56582574
2-[4-[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]piperazin-1-yl]-N-propylacetamide (PubChem CID 56582574) has the molecular formula C18H34N4O4S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-[4-[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]piperazin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]piperazin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 56582574 |
| Molecular Formula | C18H34N4O4S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2-[4-[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]piperazin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCN(C(=O)CS(=O)(=O)NC2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C18H34N4O4S/c1-3-8-19-17(23)13-21-9-11-22(12-10-21)18(24)14-27(25,26)20-16-6-4-15(2)5-7-16/h15-16,20H,3-14H2,1-2H3,(H,19,23) |
| InChIKey | WYTBASUCIOQRBI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |