C15H27N3O4S — CID 154747604
2-[(4-methylcyclohexyl)sulfamoyl]-N-(2-oxo-2-pyrrolidin-1-ylethyl)acetamide (PubChem CID 154747604) has the molecular formula C15H27N3O4S and a molecular weight of 345.47 g/mol. Its IUPAC name is 2-[(4-methylcyclohexyl)sulfamoyl]-N-(2-oxo-2-pyrrolidin-1-ylethyl)acetamide.
| Compound Name | 2-[(4-methylcyclohexyl)sulfamoyl]-N-(2-oxo-2-pyrrolidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 154747604 |
| Molecular Formula | C15H27N3O4S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[(4-methylcyclohexyl)sulfamoyl]-N-(2-oxo-2-pyrrolidin-1-ylethyl)acetamide |
| SMILES | CC1CCC(NS(=O)(=O)CC(=O)NCC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C15H27N3O4S/c1-12-4-6-13(7-5-12)17-23(21,22)11-14(19)16-10-15(20)18-8-2-3-9-18/h12-13,17H,2-11H2,1H3,(H,16,19) |
| InChIKey | MLZXSHGCCPCKMP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |