C15H32ClN3O3S — CID 119643886
N-(2-amino-2-ethylbutyl)-2-[(4-methylcyclohexyl)sulfamoyl]acetamide;hydrochloride (PubChem CID 119643886) has the molecular formula C15H32ClN3O3S and a molecular weight of 369.96 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-[(4-methylcyclohexyl)sulfamoyl]acetamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-[(4-methylcyclohexyl)sulfamoyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119643886 |
| Molecular Formula | C15H32ClN3O3S |
| Molecular Weight | 369.96 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-[(4-methylcyclohexyl)sulfamoyl]acetamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)CS(=O)(=O)NC1CCC(C)CC1.Cl |
| InChI | InChI=1S/C15H31N3O3S.ClH/c1-4-15(16,5-2)11-17-14(19)10-22(20,21)18-13-8-6-12(3)7-9-13;/h12-13,18H,4-11,16H2,1-3H3,(H,17,19);1H |
| InChIKey | JJPFRZKVQNAHFV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.96 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |