C14H26N2O5S — CID 52873250
ethyl (2S)-2-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]propanoate (PubChem CID 52873250) has the molecular formula C14H26N2O5S and a molecular weight of 334.44 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 52873250 |
| Molecular Formula | C14H26N2O5S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | ethyl (2S)-2-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NC(=O)CS(=O)(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C14H26N2O5S/c1-4-21-14(18)11(3)15-13(17)9-22(19,20)16-12-7-5-10(2)6-8-12/h10-12,16H,4-9H2,1-3H3,(H,15,17)/t10?,11-,12?/m0/s1 |
| InChIKey | CHIRYCCMVYCKTB-CXQJBGSLSA-N |
| XLogP | 0.55 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |