C15H28N2O4S — CID 95284178
2-[(4-methylcyclohexyl)sulfamoyl]-N-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]acetamide (PubChem CID 95284178) has the molecular formula C15H28N2O4S and a molecular weight of 332.47 g/mol. Its IUPAC name is 2-[(4-methylcyclohexyl)sulfamoyl]-N-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]acetamide.
| Compound Name | 2-[(4-methylcyclohexyl)sulfamoyl]-N-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 95284178 |
| Molecular Formula | C15H28N2O4S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-[(4-methylcyclohexyl)sulfamoyl]-N-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]acetamide |
| SMILES | CC1CCC(NS(=O)(=O)CC(=O)N[C@@H](C)[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C15H28N2O4S/c1-11-5-7-13(8-6-11)17-22(19,20)10-15(18)16-12(2)14-4-3-9-21-14/h11-14,17H,3-10H2,1-2H3,(H,16,18)/t11?,12-,13?,14+/m0/s1 |
| InChIKey | BPXKBHDHSNHYHI-GNRIBBGQSA-N |
| XLogP | 1.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |