C12H26ClN3O3S — CID 120507600
N-[(2S)-1-aminopropan-2-yl]-2-[(4-methylcyclohexyl)sulfamoyl]acetamide;hydrochloride (PubChem CID 120507600) has the molecular formula C12H26ClN3O3S and a molecular weight of 327.88 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-[(4-methylcyclohexyl)sulfamoyl]acetamide;hydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-[(4-methylcyclohexyl)sulfamoyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120507600 |
| Molecular Formula | C12H26ClN3O3S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-[(4-methylcyclohexyl)sulfamoyl]acetamide;hydrochloride |
| SMILES | CC1CCC(NS(=O)(=O)CC(=O)N[C@@H](C)CN)CC1.Cl |
| InChI | InChI=1S/C12H25N3O3S.ClH/c1-9-3-5-11(6-4-9)15-19(17,18)8-12(16)14-10(2)7-13;/h9-11,15H,3-8,13H2,1-2H3,(H,14,16);1H/t9?,10-,11?;/m0./s1 |
| InChIKey | FABPQYBCXVXOAQ-FNLIVBFMSA-N |
| XLogP | 0.37 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |