C16H30N2O4S — CID 102553532
2-[3-(1-hydroxyethyl)piperidin-1-yl]-N-(4-methylcyclohexyl)-2-oxoethanesulfonamide (PubChem CID 102553532) has the molecular formula C16H30N2O4S and a molecular weight of 346.49 g/mol. Its IUPAC name is 2-[3-(1-hydroxyethyl)piperidin-1-yl]-N-(4-methylcyclohexyl)-2-oxoethanesulfonamide.
| Compound Name | 2-[3-(1-hydroxyethyl)piperidin-1-yl]-N-(4-methylcyclohexyl)-2-oxoethanesulfonamide |
|---|---|
| PubChem CID | 102553532 |
| Molecular Formula | C16H30N2O4S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[3-(1-hydroxyethyl)piperidin-1-yl]-N-(4-methylcyclohexyl)-2-oxoethanesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)CC(=O)N2CCCC(C(C)O)C2)CC1 |
| InChI | InChI=1S/C16H30N2O4S/c1-12-5-7-15(8-6-12)17-23(21,22)11-16(20)18-9-3-4-14(10-18)13(2)19/h12-15,17,19H,3-11H2,1-2H3 |
| InChIKey | YUHNYEZGDUKHPG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |