C20H21NO3S — CID 56583223
N-[4-[(2E,4E)-4-methyl-5-phenylpenta-2,4-dienoyl]phenyl]ethanesulfonamide (PubChem CID 56583223) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[4-[(2E,4E)-4-methyl-5-phenylpenta-2,4-dienoyl]phenyl]ethanesulfonamide.
| Compound Name | N-[4-[(2E,4E)-4-methyl-5-phenylpenta-2,4-dienoyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 56583223 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[4-[(2E,4E)-4-methyl-5-phenylpenta-2,4-dienoyl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C(=O)/C=C/C(C)=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21NO3S/c1-3-25(23,24)21-19-12-10-18(11-13-19)20(22)14-9-16(2)15-17-7-5-4-6-8-17/h4-15,21H,3H2,1-2H3/b14-9+,16-15+ |
| InChIKey | KBZVFWQELHQQRR-MPKFQDELSA-N |
| XLogP | 4.29 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|