C23H21NO6S — CID 56583518
methyl 2-[5-[(E)-3-[4-(ethylsulfonylamino)phenyl]-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 56583518) has the molecular formula C23H21NO6S and a molecular weight of 439.49 g/mol. Its IUPAC name is methyl 2-[5-[(E)-3-[4-(ethylsulfonylamino)phenyl]-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(E)-3-[4-(ethylsulfonylamino)phenyl]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 56583518 |
| Molecular Formula | C23H21NO6S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | methyl 2-[5-[(E)-3-[4-(ethylsulfonylamino)phenyl]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCS(=O)(=O)Nc1ccc(C(=O)/C=C/c2ccc(-c3ccccc3C(=O)OC)o2)cc1 |
| InChI | InChI=1S/C23H21NO6S/c1-3-31(27,28)24-17-10-8-16(9-11-17)21(25)14-12-18-13-15-22(30-18)19-6-4-5-7-20(19)23(26)29-2/h4-15,24H,3H2,1-2H3/b14-12+ |
| InChIKey | WGMKUOJPQYZWMG-WYMLVPIESA-N |
| XLogP | 4.39 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|