C27H32N2O2 — CID 56584229
2-[benzhydryl(3-hydroxypropyl)amino]-N-(3-phenylpropyl)acetamide (PubChem CID 56584229) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[benzhydryl(3-hydroxypropyl)amino]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[benzhydryl(3-hydroxypropyl)amino]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 56584229 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 2-[benzhydryl(3-hydroxypropyl)amino]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CN(CCCO)C(c1ccccc1)c1ccccc1)NCCCc1ccccc1 |
| InChI | InChI=1S/C27H32N2O2/c30-21-11-20-29(22-26(31)28-19-10-14-23-12-4-1-5-13-23)27(24-15-6-2-7-16-24)25-17-8-3-9-18-25/h1-9,12-13,15-18,27,30H,10-11,14,19-22H2,(H,28,31) |
| InChIKey | CFHSOTJJASYFBQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|