C18H18N4O4S2 — CID 56585528
3-[methoxy(methyl)sulfamoyl]-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]benzamide (PubChem CID 56585528) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 3-[methoxy(methyl)sulfamoyl]-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]benzamide.
| Compound Name | 3-[methoxy(methyl)sulfamoyl]-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 56585528 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 3-[methoxy(methyl)sulfamoyl]-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)NCc2nc(-c3ccncc3)cs2)c1 |
| InChI | InChI=1S/C18H18N4O4S2/c1-22(26-2)28(24,25)15-5-3-4-14(10-15)18(23)20-11-17-21-16(12-27-17)13-6-8-19-9-7-13/h3-10,12H,11H2,1-2H3,(H,20,23) |
| InChIKey | OJAWTOXRGGQZMI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|