C25H21N3O2S — CID 56586190
(E)-3-(2-methoxyphenyl)-2-phenyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide (PubChem CID 56586190) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is (E)-3-(2-methoxyphenyl)-2-phenyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methoxyphenyl)-2-phenyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 56586190 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (E)-3-(2-methoxyphenyl)-2-phenyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide |
| SMILES | COc1ccccc1/C=C(/C(=O)NCc1nc(-c2ccncc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C25H21N3O2S/c1-30-23-10-6-5-9-20(23)15-21(18-7-3-2-4-8-18)25(29)27-16-24-28-22(17-31-24)19-11-13-26-14-12-19/h2-15,17H,16H2,1H3,(H,27,29)/b21-15+ |
| InChIKey | MBBCYTGCRYYQAY-RCCKNPSSSA-N |
| XLogP | 5.07 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|