C18H20BrN3O2S — CID 56586769
3-[2-[[(2-bromophenyl)methyl-methylcarbamoyl]amino]phenyl]sulfanylpropanamide (PubChem CID 56586769) has the molecular formula C18H20BrN3O2S and a molecular weight of 422.35 g/mol. Its IUPAC name is 3-[2-[[(2-bromophenyl)methyl-methylcarbamoyl]amino]phenyl]sulfanylpropanamide.
| Compound Name | 3-[2-[[(2-bromophenyl)methyl-methylcarbamoyl]amino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 56586769 |
| Molecular Formula | C18H20BrN3O2S |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 3-[2-[[(2-bromophenyl)methyl-methylcarbamoyl]amino]phenyl]sulfanylpropanamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)Nc1ccccc1SCCC(N)=O |
| InChI | InChI=1S/C18H20BrN3O2S/c1-22(12-13-6-2-3-7-14(13)19)18(24)21-15-8-4-5-9-16(15)25-11-10-17(20)23/h2-9H,10-12H2,1H3,(H2,20,23)(H,21,24) |
| InChIKey | PVZQCFWVISUSEH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |