C7H11NO — CID 56589945
(2R)-2-propyl-1,2-dihydropyrrol-5-one (PubChem CID 56589945) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (2R)-2-propyl-1,2-dihydropyrrol-5-one.
| Compound Name | (2R)-2-propyl-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 56589945 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (2R)-2-propyl-1,2-dihydropyrrol-5-one |
| SMILES | CCC[C@@H]1C=CC(=O)N1 |
| InChI | InChI=1S/C7H11NO/c1-2-3-6-4-5-7(9)8-6/h4-6H,2-3H2,1H3,(H,8,9)/t6-/m1/s1 |
| InChIKey | RLXQZBHUOTWGRB-ZCFIWIBFSA-N |
| XLogP | 0.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |