C29H27ClN2O3 — CID 56592491
4-[1-[[4-[2-(4-chlorophenyl)ethylcarbamoyl]phenyl]methyl]isoquinolin-4-yl]butanoic acid (PubChem CID 56592491) has the molecular formula C29H27ClN2O3 and a molecular weight of 487.00 g/mol. Its IUPAC name is 4-[1-[[4-[2-(4-chlorophenyl)ethylcarbamoyl]phenyl]methyl]isoquinolin-4-yl]butanoic acid.
| Compound Name | 4-[1-[[4-[2-(4-chlorophenyl)ethylcarbamoyl]phenyl]methyl]isoquinolin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 56592491 |
| Molecular Formula | C29H27ClN2O3 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 4-[1-[[4-[2-(4-chlorophenyl)ethylcarbamoyl]phenyl]methyl]isoquinolin-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1cnc(Cc2ccc(C(=O)NCCc3ccc(Cl)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C29H27ClN2O3/c30-24-14-10-20(11-15-24)16-17-31-29(35)22-12-8-21(9-13-22)18-27-26-6-2-1-5-25(26)23(19-32-27)4-3-7-28(33)34/h1-2,5-6,8-15,19H,3-4,7,16-18H2,(H,31,35)(H,33,34) |
| InChIKey | GSHSVOQRRISHSW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |