C21H40O6Si — CID 56593897
diethyl 2-[(1R,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-1,2-dimethylcyclopentyl]propanedioate (PubChem CID 56593897) has the molecular formula C21H40O6Si and a molecular weight of 416.63 g/mol. Its IUPAC name is diethyl 2-[(1R,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-1,2-dimethylcyclopentyl]propanedioate.
| Compound Name | diethyl 2-[(1R,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-1,2-dimethylcyclopentyl]propanedioate |
|---|---|
| PubChem CID | 56593897 |
| Molecular Formula | C21H40O6Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | diethyl 2-[(1R,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-1,2-dimethylcyclopentyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@]1(C)CC[C@H](O)[C@@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O6Si/c1-10-25-17(23)16(18(24)26-11-2)20(6)13-12-15(22)21(20,7)14-27-28(8,9)19(3,4)5/h15-16,22H,10-14H2,1-9H3/t15-,20+,21+/m0/s1 |
| InChIKey | KYERLSFYQMHNBU-IWMITWMQSA-N |
| XLogP | 3.92 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|