C23H44O5Si — CID 11796817
methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[2-(oxiran-2-yl)ethyl]cyclopentyl]heptanoate (PubChem CID 11796817) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[2-(oxiran-2-yl)ethyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[2-(oxiran-2-yl)ethyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 11796817 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[2-(oxiran-2-yl)ethyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](CCC2CO2)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C23H44O5Si/c1-23(2,3)29(5,6)28-21-15-20(24)18(19(21)14-13-17-16-27-17)11-9-7-8-10-12-22(25)26-4/h17-21,24H,7-16H2,1-6H3/t17?,18-,19-,20+,21-/m1/s1 |
| InChIKey | BGVUQUTXTKCJHC-VCDOQTMRSA-N |
| XLogP | 5.07 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|