C24H46O7Si2 — CID 620295
methyl 8-[2-(3-methoxy-3-oxopropyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]-6-oxooctanoate (PubChem CID 620295) has the molecular formula C24H46O7Si2 and a molecular weight of 502.80 g/mol. Its IUPAC name is methyl 8-[2-(3-methoxy-3-oxopropyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]-6-oxooctanoate.
| Compound Name | methyl 8-[2-(3-methoxy-3-oxopropyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]-6-oxooctanoate |
|---|---|
| PubChem CID | 620295 |
| Molecular Formula | C24H46O7Si2 |
| Molecular Weight | 502.80 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | methyl 8-[2-(3-methoxy-3-oxopropyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]-6-oxooctanoate |
| SMILES | COC(=O)CCCCC(=O)CCC1C(O[Si](C)(C)C)CC(O[Si](C)(C)C)C1CCC(=O)OC |
| InChI | InChI=1S/C24H46O7Si2/c1-28-23(26)12-10-9-11-18(25)13-14-19-20(15-16-24(27)29-2)22(31-33(6,7)8)17-21(19)30-32(3,4)5/h19-22H,9-17H2,1-8H3 |
| InChIKey | GNYYVBWZFLDPET-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.80 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|