C23H46O5Si2 — CID 620294
methyl 3-[2-(3-oxooctyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]propanoate (PubChem CID 620294) has the molecular formula C23H46O5Si2 and a molecular weight of 458.79 g/mol. Its IUPAC name is methyl 3-[2-(3-oxooctyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]propanoate.
| Compound Name | methyl 3-[2-(3-oxooctyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]propanoate |
|---|---|
| PubChem CID | 620294 |
| Molecular Formula | C23H46O5Si2 |
| Molecular Weight | 458.79 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | methyl 3-[2-(3-oxooctyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]propanoate |
| SMILES | CCCCCC(=O)CCC1C(O[Si](C)(C)C)CC(O[Si](C)(C)C)C1CCC(=O)OC |
| InChI | InChI=1S/C23H46O5Si2/c1-9-10-11-12-18(24)13-14-19-20(15-16-23(25)26-2)22(28-30(6,7)8)17-21(19)27-29(3,4)5/h19-22H,9-17H2,1-8H3 |
| InChIKey | SKMOAVJGKVCFNA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.79 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|