C21H38O7Si — CID 628211
methyl 7-[3,5-diacetyloxy-2-(trimethylsilyloxymethyl)cyclopentyl]heptanoate (PubChem CID 628211) has the molecular formula C21H38O7Si and a molecular weight of 430.61 g/mol. Its IUPAC name is methyl 7-[3,5-diacetyloxy-2-(trimethylsilyloxymethyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[3,5-diacetyloxy-2-(trimethylsilyloxymethyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 628211 |
| Molecular Formula | C21H38O7Si |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | methyl 7-[3,5-diacetyloxy-2-(trimethylsilyloxymethyl)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(OC(C)=O)CC(OC(C)=O)C1CO[Si](C)(C)C |
| InChI | InChI=1S/C21H38O7Si/c1-15(22)27-19-13-20(28-16(2)23)18(14-26-29(4,5)6)17(19)11-9-7-8-10-12-21(24)25-3/h17-20H,7-14H2,1-6H3 |
| InChIKey | MEVXZRQRPDPQNJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|